Drugs present in MMsINC which are similar to the molecule MMscode: MMs01727015
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.92 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.77 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.77 |
MMs01726862 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.75 |
MMs01726861 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.75 |
MMs01726859 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.75 |
MMs01726860 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.75 |
MMs01726863 | Ic1c(C(=O)NC(CO)CO)c(I)c(NC(=O)C(O)C)c(I)c1C(=O)NC(CO)CO | 0.73 |
MMs01726864 | Ic1c(C(=O)NC(CO)CO)c(I)c(NC(=O)C(O)C)c(I)c1C(=O)NC(CO)CO | 0.73 |
MMs01726847 | Ic1c(N(C(=O)C)CC(C(O)=O)C)c(I)cc(I)c1N | 0.70 |
MMs01726848 | Ic1c(N(C(=O)C)CC(C(O)=O)C)c(I)cc(I)c1N | 0.70 |