Drugs present in MMsINC which are similar to the molecule MMscode: MMs01726903
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.78 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.77 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.76 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.73 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.73 |
MMs01725759 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.73 |
MMs01725763 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.73 |
MMs01725757 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.73 |
MMs01725761 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.73 |
MMs01726110 | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.72 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.71 |