Drugs present in MMsINC which are similar to the molecule MMscode: MMs01726829
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726828 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 1.00 |
MMs01726915 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.86 |
MMs01725167 | S1c2c(N(c3c1cccc3)CCCN1CCC(CC1)CCO)cc(cc2)C(=O)C | 0.77 |
MMs01725256 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)CCO)cc(cc2)C(=O)CC | 0.74 |
MMs01725245 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)CCO)cc(cc2)C(=O)C | 0.74 |
MMs01724810 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.73 |
MMs01725321 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.73 |
MMs01724905 | S1c2c(N(c3c1cccc3)C)cc(cc2)CC(O)=O | 0.72 |
MMs01725059 | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.71 |
MMs01725254 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(cc2)C(=O)CCC | 0.71 |