Drugs present in MMsINC which are similar to the molecule MMscode: MMs01726801
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726794![]() | O1C(O)(CO)C(O)C(O)C1CO | 1.00 |
MMs01726800![]() | O1C(O)(CO)C(O)C(O)C1CO | 1.00 |
MMs01726798![]() | O1C(O)(CO)C(O)C(O)C1CO | 1.00 |
MMs01726796![]() | O1C(O)(CO)C(O)C(O)C1CO | 1.00 |
MMs01725344![]() | O1C(CO)C(O)C(O)C(O)C1O | 0.86 |
MMs01726416![]() | ClC(Cl)(Cl)C1OC2C(OC(C(O)CO)C2O)O1 | 0.73 |
MMs01726415![]() | ClC(Cl)(Cl)C1OC2C(OC(C(O)CO)C2O)O1 | 0.73 |
MMs01726414![]() | ClC(Cl)(Cl)C1OC2C(OC(C(O)CO)C2O)O1 | 0.73 |
MMs01726413![]() | ClC(Cl)(Cl)C1OC2C(OC(C(O)CO)C2O)O1 | 0.73 |