Drugs present in MMsINC which are similar to the molecule MMscode: MMs01726309
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725483 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.75 |
MMs01725472 | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01726195 | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725470 | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01726213 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01726207 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01726209 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01726211 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |