Drugs present in MMsINC which are similar to the molecule MMscode: MMs01726225
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726223![]() | s1c(nnc1SCC=1CSC2N(C(=O)C2NC(=O)Cn2nnnc2)C=1C(O)=O)C | 1.00 |
MMs01726225![]() | s1c(nnc1SCC=1CSC2N(C(=O)C2NC(=O)Cn2nnnc2)C=1C(O)=O)C | 1.00 |
MMs01726227![]() | s1c(nnc1SCC=1CSC2N(C(=O)C2NC(=O)Cn2nnnc2)C=1C(O)=O)C | 1.00 |
MMs01726229![]() | s1c(nnc1SCC=1CSC2N(C(=O)C2NC(=O)Cn2nnnc2)C=1C(O)=O)C | 1.00 |
MMs01726249![]() | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726243![]() | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726245![]() | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726247![]() | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.76 |
MMs01726235![]() | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726237![]() | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726239![]() | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726241![]() | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.70 |