Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725653
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725856 | O=C1NC(=O)NC(=O)C1(C(CC)C)CC | 0.82 |
MMs01725405 | O=C1NC(=O)NC(=O)C1(C(CCC)C)CC | 0.79 |
MMs01724848 | BrC(CC)(CC)C(=O)NC(=O)N | 0.72 |
MMs01727426 | S=C1NC(=O)C(C(CCC)C)(CC)C(=O)N1 | 0.71 |
MMs01727427 | S=C1NC(=O)C(C(CCC)C)(CC)C(=O)N1 | 0.71 |
MMs01725802 | O=C1NC(=O)NC(=O)C1(C(CC)C)CC=C | 0.71 |
MMs01727397 | O=C1NC(=O)NC(=O)C1(C(CC)C)CC=C | 0.71 |