Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725560
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725559 | O(CCCCCOc1ccc(cc1)C(N)=N)c1ccc(cc1)C(N)=N | 1.00 |
MMs01724895 | Oc1cc(ccc1\C=C\c1ccc(cc1)C(N)=N)C(N)=N | 0.77 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.77 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.72 |
MMs01725329 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.72 |
MMs01724919 | O(CCN(C)C)c1ccccc1Cc1ccccc1 | 0.72 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726882 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726884 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726886 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |