Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725198
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725198 | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CC | 1.00 |
MMs01727124 | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CCN(Cc1ccccc1)C | 0.91 |
MMs01727142 | O(C(=O)C1C(C(C(OC)=O)C(=NC1=C)C)c1ccccc1[N+](=O)[O-])CC(C)C | 0.89 |
MMs01725876 | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)C1CCCN(C1)Cc1ccccc1 | 0.87 |
MMs01725194 | Clc1c(cccc1Cl)C1C(C(OCC)=O)C(=NC(C)=C1C(OC)=O)C | 0.74 |