Drugs present in MMsINC which are similar to the molecule MMscode: MMs01725031
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.83 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.82 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.78 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.75 |
MMs01724819 | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.72 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.71 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.70 |