Drugs present in MMsINC which are similar to the molecule MMscode: MMs01724834
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724834 | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 1.00 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.96 |
MMs01725825 | Brc1sc2-n3c(nnc3C)CN=C(c2c1)c1ccccc1Cl | 0.78 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.70 |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.70 |