Drugs present in MMsINC which are similar to the molecule MMscode: MMs01719959
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725061![]() | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.82 |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.75 |
MMs01725632![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.75 |
MMs01724865![]() | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.75 |
MMs01724782![]() | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.75 |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.72 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.72 |
MMs01725803![]() | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.72 |
MMs01724862![]() | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.70 |