Drugs present in MMsINC which are similar to the molecule MMscode: MMs01717611
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.81 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.80 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.77 |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.77 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.72 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.72 |
MMs01725084![]() | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |