Drugs present in MMsINC which are similar to the molecule MMscode: MMs01707849
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726749 | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.75 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.72 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.72 |
MMs01725219 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.72 |
MMs01725015 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.70 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.70 |
MMs01725857 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.70 |
MMs01726462 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.70 |