Drugs present in MMsINC which are similar to the molecule MMscode: MMs01702784
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725055![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.74 |
MMs01724969![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.74 |
MMs01725008![]() | S1c2c(N(c3c1cccc3)CCC[NH+](C)C)cccc2 | 0.72 |
MMs01724778![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.72 |
MMs01725302![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.72 |
MMs01725300![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.71 |
MMs01724823![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.71 |
MMs01725656![]() | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.70 |
MMs01725173![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.70 |