Drugs present in MMsINC which are similar to the molecule MMscode: MMs01687305
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.72 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01724973 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01725329 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.71 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.71 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.70 |