Drugs present in MMsINC which are similar to the molecule MMscode: MMs01680482
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724990 | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.71 |
MMs01725232 | S(=O)(=O)(Nc1cc2cc([nH]c2cc1)C(=O)N1CCN(CC1)c1ncccc1NC(C)C)C | 0.71 |
MMs01725479 | s1cc(nc1N)/C(=N\OC(C(O)=O)(C)C)/C(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01726337 | s1cc(nc1N)/C(=N\OC(C(O)=O)(C)C)/C(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01726339 | s1cc(nc1N)/C(=N\OC(C(O)=O)(C)C)/C(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01726341 | s1cc(nc1N)/C(=N\OC(C(O)=O)(C)C)/C(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |