Drugs present in MMsINC which are similar to the molecule MMscode: MMs01671038
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725170 | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.81 |
MMs01725781 | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.73 |
MMs01727406 | s1cccc1C1OC2C(OC(OC3C4C(C(c5c3cc3OCOc3c5)c3cc(OC)c(O)c(OC)c3)C(OC4)=O)C(O)C2O)CO1 | 0.70 |
MMs01727407 | s1cccc1C1OC2C(OC(OC3C4C(C(c5c3cc3OCOc3c5)c3cc(OC)c(O)c(OC)c3)C(OC4)=O)C(O)C2O)CO1 | 0.70 |
MMs01727408 | s1cccc1C1OC2C(OC(OC3C4C(C(c5c3cc3OCOc3c5)c3cc(OC)c(O)c(OC)c3)C(OC4)=O)C(O)C2O)CO1 | 0.70 |
MMs01727409 | s1cccc1C1OC2C(OC(OC3C4C(C(c5c3cc3OCOc3c5)c3cc(OC)c(O)c(OC)c3)C(OC4)=O)C(O)C2O)CO1 | 0.70 |