Drugs present in MMsINC which are similar to the molecule MMscode: MMs01667770
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.78 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.72 |
MMs01724760 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.71 |
MMs01725155 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.71 |
MMs01725156 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.71 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.70 |