Drugs present in MMsINC which are similar to the molecule MMscode: MMs01639212
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.89 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01726825![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.72 |
MMs01726823![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.72 |
MMs01726821![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.72 |
MMs01725110![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01724773![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.71 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01725828![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725538![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.70 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.70 |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.70 |