Drugs present in MMsINC which are similar to the molecule MMscode: MMs01638256
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725757![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.75 |
MMs01725759![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.75 |
MMs01725761![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.75 |
MMs01725763![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.75 |
MMs01726749![]() | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.72 |