Drugs present in MMsINC which are similar to the molecule MMscode: MMs01635896
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724990 | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.77 |
MMs01726401 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01726395 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01726397 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01726399 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.72 |
MMs01725013 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.71 |
MMs01725694 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.71 |
MMs01725844 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725846 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725609 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725842 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |