Drugs present in MMsINC which are similar to the molecule MMscode: MMs01512285
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727179![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.75 |
MMs01727180![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.75 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.73 |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.73 |
MMs01724837![]() | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.72 |