Drugs present in MMsINC which are similar to the molecule MMscode: MMs01510660
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.78 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.77 |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.74 |
MMs01726820![]() | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.71 |
MMs01726819![]() | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.71 |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.70 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.70 |