Drugs present in MMsINC which are similar to the molecule MMscode: MMs01506482
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724770 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CCC[N+](C1)(C)C | 0.77 |
MMs01725118 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.76 |
MMs01725540 | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.75 |
MMs01725542 | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.75 |
MMs01725086 | O(CC1=NCCCN1C)C(=O)C(O)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01726477 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1C2CC[N+](C1)(CC2)C | 0.73 |
MMs01725189 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CC2[N+]3(C(C1)CC2)CCCC3 | 0.71 |