Drugs present in MMsINC which are similar to the molecule MMscode: MMs01487336
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727381![]() | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.75 |
MMs01725193![]() | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.74 |
MMs01725378![]() | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.74 |
MMs01724823![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.73 |
MMs01725055![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.73 |
MMs01724778![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01725173![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.71 |
MMs01725519![]() | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.70 |
MMs01725521![]() | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.70 |