Drugs present in MMsINC which are similar to the molecule MMscode: MMs01469624
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724770![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CCC[N+](C1)(C)C | 0.78 |
MMs01725118![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.77 |
MMs01726477![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1C2CC[N+](C1)(CC2)C | 0.74 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.73 |
MMs01725542![]() | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.72 |
MMs01725540![]() | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.72 |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.71 |
MMs01727088![]() | O1CCCC1CC(Cc1c2c(ccc1)cccc2)C(OCCN(CC)CC)=O | 0.71 |
MMs01727090![]() | O1CCCC1CC(Cc1c2c(ccc1)cccc2)C(OCCN(CC)CC)=O | 0.71 |
MMs01727092![]() | O1CCCC1CC(Cc1c2c(ccc1)cccc2)C(OCCN(CC)CC)=O | 0.71 |
MMs01725189![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CC2[N+]3(C(C1)CC2)CCCC3 | 0.70 |