Drugs present in MMsINC which are similar to the molecule MMscode: MMs01451769
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.80 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.76 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.73 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.73 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01726819 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.70 |
MMs01726820 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.70 |