Drugs present in MMsINC which are similar to the molecule MMscode: MMs01447301
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725860 | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.78 |
MMs01725826 | S(=O)(=O)(N)c1ccc(-n2nc(cc2-c2ccc(cc2)C)C(F)(F)F)cc1 | 0.72 |
MMs01724945 | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.72 |
MMs01724928 | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.70 |
MMs01724996 | O=C(N(CC)c1cc(ccc1)C=1n2ncc(c2N=CC=1)C#N)C | 0.70 |