Drugs present in MMsINC which are similar to the molecule MMscode: MMs01407610
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.81 |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.72 |
MMs01725288 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.72 |
MMs01725221 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.70 |
MMs01726924 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.70 |