Drugs present in MMsINC which are similar to the molecule MMscode: MMs01394280
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725002![]() | Oc1c-2c(CC3N(CCc4c3c-2ccc4)C)ccc1O | 0.76 |
MMs01726900![]() | Oc1cc2C34C(C(N(CC3)CC=C)Cc2cc1)CCCC4 | 0.72 |
MMs01724795![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01725029![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.70 |