Drugs present in MMsINC which are similar to the molecule MMscode: MMs01390306
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.76 |
MMs01725691 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.76 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.70 |
MMs01726882 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.70 |
MMs01726884 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.70 |
MMs01726886 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.70 |