Drugs present in MMsINC which are similar to the molecule MMscode: MMs01380736
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01725751![]() | Clc1cc(ccc1OCC=C)CC(O)=O | 0.72 |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.72 |
MMs01726736![]() | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.70 |
MMs01725109![]() | O(CC(O)CO)c1ccccc1C | 0.70 |
MMs01724771![]() | O(CC(O)CO)c1ccccc1C | 0.70 |