Drugs present in MMsINC which are similar to the molecule MMscode: MMs01368985
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727511 | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.76 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.76 |
MMs01725587 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](CC)(CC)C)=O | 0.75 |
MMs01726071 | O(C(=O)C)C1CC2N(CC1C(=O)N(CC)CC)CCc1cc(OC)c(OC)cc12 | 0.74 |
MMs01725280 | O(C(=O)C)C1CC2N(CC1C(=O)N(CC)CC)CCc1cc(OC)c(OC)cc12 | 0.74 |
MMs01725691 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.73 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.73 |
MMs01725361 | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.73 |
MMs01727045 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.72 |
MMs01727049 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.72 |
MMs01727043 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.72 |
MMs01727047 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |