Drugs present in MMsINC which are similar to the molecule MMscode: MMs01362484
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.74 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.74 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.72 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.72 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.72 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.72 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.72 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.72 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.72 |
MMs01725761 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725763 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725759 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725757 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.70 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.70 |