Drugs present in MMsINC which are similar to the molecule MMscode: MMs01357007
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727136![]() | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.83 |
MMs01726846![]() | O(C(=O)c1cccnc1)C1C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1OC(=O)c1cccnc1 | 0.81 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.80 |
MMs01727140![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.79 |
MMs01727137![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.79 |
MMs01727138![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.79 |
MMs01727139![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.79 |
MMs01725112![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.75 |
MMs01724747![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.75 |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.74 |












