Drugs present in MMsINC which are similar to the molecule MMscode: MMs01343732
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.75 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.75 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.75 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.75 |
MMs01725077![]() | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.74 |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.72 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |