Drugs present in MMsINC which are similar to the molecule MMscode: MMs01341971
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725623 | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.73 |
MMs01725927 | O(CC(O)CNC(C)(C)C)c1c2c(ccc1)C(=O)CCC2 | 0.72 |
MMs01726126 | O(CC(O)CNC(C)(C)C)c1c2c(ccc1)C(=O)CCC2 | 0.72 |
MMs01727084 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01727082 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01725534 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01727086 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01725262 | O1c2c(cccc2C(OCCN2CCCCC2)=O)C(=O)C(C)=C1c1ccccc1 | 0.72 |
MMs01725761 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725757 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725759 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725763 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725219 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.71 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.71 |