Drugs present in MMsINC which are similar to the molecule MMscode: MMs01331329
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725799![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.78 |
MMs01724875![]() | Clc1cc2S(=O)(=O)NC(=Nc2cc1)C | 0.76 |
MMs01725853![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.74 |
MMs01724792![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |
MMs01725796![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |
MMs01726782![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.70 |
MMs01726784![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.70 |
MMs01724851![]() | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.70 |










