Drugs present in MMsINC which are similar to the molecule MMscode: MMs01281408
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.79 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.79 |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.76 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.74 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.70 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.70 |