Drugs present in MMsINC which are similar to the molecule MMscode: MMs01247962
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.74 |
MMs01726820 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.73 |
MMs01726819 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.73 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.72 |
MMs01726110 | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.71 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.71 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.71 |