Drugs present in MMsINC which are similar to the molecule MMscode: MMs01239255
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.75 |
MMs01725853 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.72 |
MMs01725227 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.72 |
MMs01725233 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.72 |
MMs01725799 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.72 |
MMs01725351 | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.70 |
MMs01725349 | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.70 |