Drugs present in MMsINC which are similar to the molecule MMscode: MMs01234340
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725378 | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.76 |
MMs01725193 | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.76 |
MMs01725656 | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.75 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.75 |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.74 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.72 |
MMs01725225 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01727381 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725345 | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.70 |
MMs01725223 | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.70 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.70 |