Drugs present in MMsINC which are similar to the molecule MMscode: MMs01231116
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.76 |
MMs01724772![]() | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01725806![]() | O1C(CNC1=O)COc1ccccc1OC | 0.72 |
MMs01725169![]() | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.72 |
MMs01725721![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.72 |