Drugs present in MMsINC which are similar to the molecule MMscode: MMs01231107
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.73 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.73 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.72 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.70 |