Drugs present in MMsINC which are similar to the molecule MMscode: MMs01229539
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724833![]() | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.87 |
MMs01724876![]() | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.78 |
MMs01725453![]() | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.76 |
MMs01724773![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01725110![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |








