Drugs present in MMsINC which are similar to the molecule MMscode: MMs01225939
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724790 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.80 |
MMs01725317 | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.80 |
MMs01725075 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.79 |
MMs01725073 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.79 |
MMs01725023 | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01724903 | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01725662 | Oc1cc(ccc1)C(O)C(N)C | 0.70 |
MMs01725664 | Oc1cc(ccc1)C(O)C(N)C | 0.70 |