Drugs present in MMsINC which are similar to the molecule MMscode: MMs01212712
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725219![]() | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.74 |
MMs01725384![]() | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.74 |
MMs01725388![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.73 |
MMs01724973![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.73 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.72 |
MMs01725623![]() | S(=O)(=O)(C)c1cc(C(=O)NCCN(CC)CC)c(OC)cc1 | 0.71 |
MMs01725777![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01726971![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01726973![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |











