Drugs present in MMsINC which are similar to the molecule MMscode: MMs01206671
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724928 | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.77 |
MMs01724762 | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.77 |
MMs01725677 | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.72 |
MMs01724980 | FC(F)(F)c1ccc(NC(=O)c2cnoc2C)cc1 | 0.72 |
MMs01724996 | O=C(N(CC)c1cc(ccc1)C=1n2ncc(c2N=CC=1)C#N)C | 0.71 |