Drugs present in MMsINC which are similar to the molecule MMscode: MMs01206330
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724762![]() | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.83 |
MMs01725677![]() | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.77 |
MMs01724928![]() | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.75 |
MMs01724996![]() | O=C(N(CC)c1cc(ccc1)C=1n2ncc(c2N=CC=1)C#N)C | 0.73 |
MMs01724945![]() | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.73 |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |